C10H10ClNOS2 — CID 122379571
3-[(2-chlorophenyl)methyl]-4-hydroxy-1,3-thiazolidine-2-thione (PubChem CID 122379571) has the molecular formula C10H10ClNOS2 and a molecular weight of 259.78 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-4-hydroxy-1,3-thiazolidine-2-thione.
| Compound Name | 3-[(2-chlorophenyl)methyl]-4-hydroxy-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 122379571 |
| Molecular Formula | C10H10ClNOS2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 258.99 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-4-hydroxy-1,3-thiazolidine-2-thione |
| SMILES | OC1CSC(=S)N1Cc1ccccc1Cl |
| InChI | InChI=1S/C10H10ClNOS2/c11-8-4-2-1-3-7(8)5-12-9(13)6-15-10(12)14/h1-4,9,13H,5-6H2 |
| InChIKey | RJRXLUQVEDXVQA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|