C16H22ClNO2 — CID 166293998
(8R,9S)-6-[(2-chlorophenyl)methyl]-6-azaspiro[4.5]decane-8,9-diol (PubChem CID 166293998) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is (8R,9S)-6-[(2-chlorophenyl)methyl]-6-azaspiro[4.5]decane-8,9-diol.
| Compound Name | (8R,9S)-6-[(2-chlorophenyl)methyl]-6-azaspiro[4.5]decane-8,9-diol |
|---|---|
| PubChem CID | 166293998 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | (8R,9S)-6-[(2-chlorophenyl)methyl]-6-azaspiro[4.5]decane-8,9-diol |
| SMILES | O[C@@H]1CN(Cc2ccccc2Cl)C2(CCCC2)C[C@@H]1O |
| InChI | InChI=1S/C16H22ClNO2/c17-13-6-2-1-5-12(13)10-18-11-15(20)14(19)9-16(18)7-3-4-8-16/h1-2,5-6,14-15,19-20H,3-4,7-11H2/t14-,15+/m0/s1 |
| InChIKey | ZFURGRMZJSZCAP-LSDHHAIUSA-N |
| XLogP | 2.58 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |