C6H11NOS2 — CID 122379575
4-hydroxy-3-propyl-1,3-thiazolidine-2-thione (PubChem CID 122379575) has the molecular formula C6H11NOS2 and a molecular weight of 177.29 g/mol. Its IUPAC name is 4-hydroxy-3-propyl-1,3-thiazolidine-2-thione.
| Compound Name | 4-hydroxy-3-propyl-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 122379575 |
| Molecular Formula | C6H11NOS2 |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.03 |
| IUPAC Name | 4-hydroxy-3-propyl-1,3-thiazolidine-2-thione |
| SMILES | CCCN1C(=S)SCC1O |
| InChI | InChI=1S/C6H11NOS2/c1-2-3-7-5(8)4-10-6(7)9/h5,8H,2-4H2,1H3 |
| InChIKey | WUSVCIXQHXFQAN-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|