C7H13NOS2 — CID 20648623
1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propane-1-thione (PubChem CID 20648623) has the molecular formula C7H13NOS2 and a molecular weight of 191.32 g/mol. Its IUPAC name is 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propane-1-thione.
| Compound Name | 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propane-1-thione |
|---|---|
| PubChem CID | 20648623 |
| Molecular Formula | C7H13NOS2 |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | 1-[4-(hydroxymethyl)-1,3-thiazolidin-3-yl]propane-1-thione |
| SMILES | CCC(=S)N1CSCC1CO |
| InChI | InChI=1S/C7H13NOS2/c1-2-7(10)8-5-11-4-6(8)3-9/h6,9H,2-5H2,1H3 |
| InChIKey | PIYYCSZTSMNYEV-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|