C43H46BNO — CID 122379695
1,3,6,8-tetramethyl-9-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]carbazole (PubChem CID 122379695) has the molecular formula C43H46BNO and a molecular weight of 603.66 g/mol. Its IUPAC name is 1,3,6,8-tetramethyl-9-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]carbazole.
| Compound Name | 1,3,6,8-tetramethyl-9-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]carbazole |
|---|---|
| PubChem CID | 122379695 |
| Molecular Formula | C43H46BNO |
| Molecular Weight | 603.66 g/mol |
| Exact Mass | 603.37 |
| IUPAC Name | 1,3,6,8-tetramethyl-9-[10-[2,4,6-tri(propan-2-yl)phenyl]benzo[b][1,4]benzoxaborinin-3-yl]carbazole |
| SMILES | Cc1cc(C)c2c(c1)c1cc(C)cc(C)c1n2-c1ccc2c(c1)Oc1ccccc1B2c1c(C(C)C)cc(C(C)C)cc1C(C)C |
| InChI | InChI=1S/C43H46BNO/c1-24(2)31-21-33(25(3)4)41(34(22-31)26(5)6)44-37-13-11-12-14-39(37)46-40-23-32(15-16-38(40)44)45-42-29(9)17-27(7)19-35(42)36-20-28(8)18-30(10)43(36)45/h11-26H,1-10H3 |
| InChIKey | RNHLMGGVHAHFFS-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.66 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|