C18H30O4S2 — CID 122379701
3-[6-(2-acetyl-3-oxobutyl)sulfanylhexylsulfanylmethyl]pentane-2,4-dione (PubChem CID 122379701) has the molecular formula C18H30O4S2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 3-[6-(2-acetyl-3-oxobutyl)sulfanylhexylsulfanylmethyl]pentane-2,4-dione.
| Compound Name | 3-[6-(2-acetyl-3-oxobutyl)sulfanylhexylsulfanylmethyl]pentane-2,4-dione |
|---|---|
| PubChem CID | 122379701 |
| Molecular Formula | C18H30O4S2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 3-[6-(2-acetyl-3-oxobutyl)sulfanylhexylsulfanylmethyl]pentane-2,4-dione |
| SMILES | CC(=O)C(CSCCCCCCSCC(C(C)=O)C(C)=O)C(C)=O |
| InChI | InChI=1S/C18H30O4S2/c1-13(19)17(14(2)20)11-23-9-7-5-6-8-10-24-12-18(15(3)21)16(4)22/h17-18H,5-12H2,1-4H3 |
| InChIKey | VSRUCLLMZFDAHT-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|