C20H20N2OS — CID 122380196
2-(4-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide (PubChem CID 122380196) has the molecular formula C20H20N2OS and a molecular weight of 336.46 g/mol. Its IUPAC name is 2-(4-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide.
| Compound Name | 2-(4-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 122380196 |
| Molecular Formula | C20H20N2OS |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 2-(4-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide |
| SMILES | Cc1csc(-c2ccccc2C(=O)NC(C)(C)c2ccccn2)c1 |
| InChI | InChI=1S/C20H20N2OS/c1-14-12-17(24-13-14)15-8-4-5-9-16(15)19(23)22-20(2,3)18-10-6-7-11-21-18/h4-13H,1-3H3,(H,22,23) |
| InChIKey | MPNSBNHRRBIYSN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |