C20H19IN2OS — CID 166442652
4-iodo-2-(5-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide (PubChem CID 166442652) has the molecular formula C20H19IN2OS and a molecular weight of 462.36 g/mol. Its IUPAC name is 4-iodo-2-(5-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide.
| Compound Name | 4-iodo-2-(5-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 166442652 |
| Molecular Formula | C20H19IN2OS |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 462.03 |
| IUPAC Name | 4-iodo-2-(5-methylthiophen-2-yl)-N-(2-pyridin-2-ylpropan-2-yl)benzamide |
| SMILES | Cc1ccc(-c2cc(I)ccc2C(=O)NC(C)(C)c2ccccn2)s1 |
| InChI | InChI=1S/C20H19IN2OS/c1-13-7-10-17(25-13)16-12-14(21)8-9-15(16)19(24)23-20(2,3)18-6-4-5-11-22-18/h4-12H,1-3H3,(H,23,24) |
| InChIKey | HVYREIZEAPKNKC-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|