About 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole
8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole (PubChem CID 122380669) has the molecular formula C21H21NO2
and a molecular weight of 319.40 g/mol. Its IUPAC name is 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole.
Molecular Properties
| Compound Name | 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole |
| PubChem CID | 122380669 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole |
| SMILES | C#CC(c1ccc(OC)cc1)C12CCOC1N(C)c1ccccc12 |
| InChI | InChI=1S/C21H21NO2/c1-4-17(15-9-11-16(23-3)12-10-15)21-13-14-24-20(21)22(2)19-8-6-5-7-18(19)21/h1,5-12,17,20H,13-14H2,2-3H3 |
| InChIKey | BHEAMQCGZYSYHT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The IUPAC name of 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole (CID 122380669) is 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole.
What is the SMILES notation for 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The canonical SMILES for 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole is C#CC(c1ccc(OC)cc1)C12CCOC1N(C)c1ccccc12.
What is the InChIKey of 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
The InChIKey is BHEAMQCGZYSYHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2/c1-4-17(15-9-11-16(23-3)12-10-15)21-13-14-24-20(21)22(2)19-8-6-5-7-18(19)21/h1,5-12,17,20H,13-14H2,2-3H3.
What are the key properties of 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole?
8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole has a molecular weight of 319.40 g/mol, XLogP of 3.55, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8b-[1-(4-methoxyphenyl)prop-2-ynyl]-4-methyl-2,3a-dihydro-1H-furo[2,3-b]indole is sourced from PubChem (CID 122380669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).