C13H17ClN2O — CID 91664109
2-(4-methoxyphenyl)-2-pyrrolidin-1-ylacetonitrile;hydrochloride (PubChem CID 91664109) has the molecular formula C13H17ClN2O and a molecular weight of 252.75 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-pyrrolidin-1-ylacetonitrile;hydrochloride.
| Compound Name | 2-(4-methoxyphenyl)-2-pyrrolidin-1-ylacetonitrile;hydrochloride |
|---|---|
| PubChem CID | 91664109 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.75 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-pyrrolidin-1-ylacetonitrile;hydrochloride |
| SMILES | COc1ccc(C(C#N)N2CCCC2)cc1.Cl |
| InChI | InChI=1S/C13H16N2O.ClH/c1-16-12-6-4-11(5-7-12)13(10-14)15-8-2-3-9-15;/h4-7,13H,2-3,8-9H2,1H3;1H |
| InChIKey | IXWNRHWMJMKNTA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.75 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |