C29H26N2O5S — CID 122382592
2-[(3S,4R,5S)-1-(4-methylphenyl)sulfonyl-4-nitro-5-phenylpyrrolidin-3-yl]-1-naphthalen-2-ylethanone (PubChem CID 122382592) has the molecular formula C29H26N2O5S and a molecular weight of 514.60 g/mol. Its IUPAC name is 2-[(3S,4R,5S)-1-(4-methylphenyl)sulfonyl-4-nitro-5-phenylpyrrolidin-3-yl]-1-naphthalen-2-ylethanone.
| Compound Name | 2-[(3S,4R,5S)-1-(4-methylphenyl)sulfonyl-4-nitro-5-phenylpyrrolidin-3-yl]-1-naphthalen-2-ylethanone |
|---|---|
| PubChem CID | 122382592 |
| Molecular Formula | C29H26N2O5S |
| Molecular Weight | 514.60 g/mol |
| Exact Mass | 514.16 |
| IUPAC Name | 2-[(3S,4R,5S)-1-(4-methylphenyl)sulfonyl-4-nitro-5-phenylpyrrolidin-3-yl]-1-naphthalen-2-ylethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2C[C@H](CC(=O)c3ccc4ccccc4c3)[C@@H]([N+](=O)[O-])[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2O5S/c1-20-11-15-26(16-12-20)37(35,36)30-19-25(29(31(33)34)28(30)22-8-3-2-4-9-22)18-27(32)24-14-13-21-7-5-6-10-23(21)17-24/h2-17,25,28-29H,18-19H2,1H3/t25-,28-,29+/m0/s1 |
| InChIKey | UKSAQWFGWAPVQN-OWPQXHQJSA-N |
| XLogP | 5.43 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.60 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|