methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate

C18H18O4 — CID 122384679

IUPACmethyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate
SMILESCOC(=O)c1ccc(-c2ccc(C3(C)OCCO3)cc2)cc1
InChIInChI=1S/C18H18O4/c1-18(21-11-12-22-18)16-9-7-14(8-10-16)13-3-5-15(6-4-13)17(19)20-2/h3-10H,11-12H2,1-2H3
InChIKeyIEOABYBQELGKCP-UHFFFAOYSA-N
MW298.34 g/mol
LogP3.36
Rot. Bonds3

About methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate

methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate (PubChem CID 122384679) has the molecular formula C18H18O4 and a molecular weight of 298.34 g/mol. Its IUPAC name is methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate.

Molecular Properties

Compound Namemethyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate
PubChem CID122384679
Molecular FormulaC18H18O4
Molecular Weight298.34 g/mol
Exact Mass298.12
IUPAC Namemethyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate
SMILESCOC(=O)c1ccc(-c2ccc(C3(C)OCCO3)cc2)cc1
InChIInChI=1S/C18H18O4/c1-18(21-11-12-22-18)16-9-7-14(8-10-16)13-3-5-15(6-4-13)17(19)20-2/h3-10H,11-12H2,1-2H3
InChIKeyIEOABYBQELGKCP-UHFFFAOYSA-N
XLogP3.36
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.34
LogP ≤ 53.36
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate?
The IUPAC name of methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate (CID 122384679) is methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate.
What is the SMILES notation for methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate?
The canonical SMILES for methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate is COC(=O)c1ccc(-c2ccc(C3(C)OCCO3)cc2)cc1.
What is the InChIKey of methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate?
The InChIKey is IEOABYBQELGKCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18O4/c1-18(21-11-12-22-18)16-9-7-14(8-10-16)13-3-5-15(6-4-13)17(19)20-2/h3-10H,11-12H2,1-2H3.
What are the key properties of methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate?
methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate has a molecular weight of 298.34 g/mol, XLogP of 3.36, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[4-(2-methyl-1,3-dioxolan-2-yl)phenyl]benzoate is sourced from PubChem (CID 122384679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).