C28H39NP2 — CID 122386943
2-dicyclohexylphosphanyl-N-(2-diphenylphosphanylethyl)ethanimine (PubChem CID 122386943) has the molecular formula C28H39NP2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 2-dicyclohexylphosphanyl-N-(2-diphenylphosphanylethyl)ethanimine.
| Compound Name | 2-dicyclohexylphosphanyl-N-(2-diphenylphosphanylethyl)ethanimine |
|---|---|
| PubChem CID | 122386943 |
| Molecular Formula | C28H39NP2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.26 |
| IUPAC Name | 2-dicyclohexylphosphanyl-N-(2-diphenylphosphanylethyl)ethanimine |
| SMILES | C(\CP(C1CCCCC1)C1CCCCC1)=N/CCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H39NP2/c1-5-13-25(14-6-1)30(26-15-7-2-8-16-26)23-21-29-22-24-31(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-2,5-8,13-16,22,27-28H,3-4,9-12,17-21,23-24H2/b29-22+ |
| InChIKey | CJRTXHSOXHEXSD-QUPMIFSKSA-N |
| XLogP | 7.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|