C66H76N2O4S2 — CID 122390338
2-[(5Z)-5-[[5-[4-[bis(9,9-dihexylfluoren-2-yl)amino]phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid (PubChem CID 122390338) has the molecular formula C66H76N2O4S2 and a molecular weight of 1025.48 g/mol. Its IUPAC name is 2-[(5Z)-5-[[5-[4-[bis(9,9-dihexylfluoren-2-yl)amino]phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid.
| Compound Name | 2-[(5Z)-5-[[5-[4-[bis(9,9-dihexylfluoren-2-yl)amino]phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 122390338 |
| Molecular Formula | C66H76N2O4S2 |
| Molecular Weight | 1025.48 g/mol |
| Exact Mass | 1024.52 |
| IUPAC Name | 2-[(5Z)-5-[[5-[4-[bis(9,9-dihexylfluoren-2-yl)amino]phenyl]furan-2-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]acetic acid |
| SMILES | CCCCCCC1(CCCCCC)c2ccccc2-c2ccc(N(c3ccc(-c4ccc(/C=C5\SC(=S)N(CC(=O)O)C5=O)o4)cc3)c3ccc4c(c3)C(CCCCCC)(CCCCCC)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C66H76N2O4S2/c1-5-9-13-21-39-65(40-22-14-10-6-2)56-27-19-17-25-52(56)54-36-33-49(43-58(54)65)68(48-31-29-47(30-32-48)60-38-35-51(72-60)45-61-63(71)67(46-62(69)70)64(73)74-61)50-34-37-55-53-26-18-20-28-57(53)66(59(55)44-50,41-23-15-11-7-3)42-24-16-12-8-4/h17-20,25-38,43-45H,5-16,21-24,39-42,46H2,1-4H3,(H,69,70)/b61-45- |
| InChIKey | RJLJROORUBIWLH-UBXQPOIZSA-N |
| XLogP | 19.12 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1025.48 |
| LogP ≤ 5 | 19.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|