C21H38NO4- — CID 122391300
(2S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]propanoate (PubChem CID 122391300) has the molecular formula C21H38NO4- and a molecular weight of 368.54 g/mol. Its IUPAC name is (2S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]propanoate.
| Compound Name | (2S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]propanoate |
|---|---|
| PubChem CID | 122391300 |
| Molecular Formula | C21H38NO4- |
| Molecular Weight | 368.54 g/mol |
| Exact Mass | 368.28 |
| IUPAC Name | (2S)-3-hydroxy-2-[[(Z)-octadec-9-enoyl]amino]propanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CO)C(=O)[O-] |
| InChI | InChI=1S/C21H39NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(24)22-19(18-23)21(25)26/h9-10,19,23H,2-8,11-18H2,1H3,(H,22,24)(H,25,26)/p-1/b10-9-/t19-/m0/s1 |
| InChIKey | MBDKGXAMSZIDKF-VJIACCKLSA-M |
| XLogP | 3.25 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|