C28H30FN3 — CID 122391424
N,3-dicyclohexyl-7-fluoro-1-phenylpyrrolo[2,3-b]indol-2-imine (PubChem CID 122391424) has the molecular formula C28H30FN3 and a molecular weight of 427.57 g/mol. Its IUPAC name is N,3-dicyclohexyl-7-fluoro-1-phenylpyrrolo[2,3-b]indol-2-imine.
| Compound Name | N,3-dicyclohexyl-7-fluoro-1-phenylpyrrolo[2,3-b]indol-2-imine |
|---|---|
| PubChem CID | 122391424 |
| Molecular Formula | C28H30FN3 |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.24 |
| IUPAC Name | N,3-dicyclohexyl-7-fluoro-1-phenylpyrrolo[2,3-b]indol-2-imine |
| SMILES | Fc1ccc2c(c1)C1=C(c3ccccc3)/C(=N/C3CCCCC3)N(C3CCCCC3)C1=N2 |
| InChI | InChI=1S/C28H30FN3/c29-20-16-17-24-23(18-20)26-25(19-10-4-1-5-11-19)27(30-21-12-6-2-7-13-21)32(28(26)31-24)22-14-8-3-9-15-22/h1,4-5,10-11,16-18,21-22H,2-3,6-9,12-15H2/b30-27- |
| InChIKey | NZIBFHBFHFSDPT-IKPAITLHSA-N |
| XLogP | 7.16 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|