C15H27NO2 — CID 122392019
tert-butyl (2E)-2-butylideneazepane-1-carboxylate (PubChem CID 122392019) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is tert-butyl (2E)-2-butylideneazepane-1-carboxylate.
| Compound Name | tert-butyl (2E)-2-butylideneazepane-1-carboxylate |
|---|---|
| PubChem CID | 122392019 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | tert-butyl (2E)-2-butylideneazepane-1-carboxylate |
| SMILES | CCC/C=C1\CCCCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H27NO2/c1-5-6-10-13-11-8-7-9-12-16(13)14(17)18-15(2,3)4/h10H,5-9,11-12H2,1-4H3/b13-10+ |
| InChIKey | FYTZKRNJCCHAGV-JLHYYAGUSA-N |
| XLogP | 4.48 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |