C24H28O3S — CID 122393966
[(3R)-oct-1-en-3-yl] 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate (PubChem CID 122393966) has the molecular formula C24H28O3S and a molecular weight of 396.55 g/mol. Its IUPAC name is [(3R)-oct-1-en-3-yl] 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate.
| Compound Name | [(3R)-oct-1-en-3-yl] 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate |
|---|---|
| PubChem CID | 122393966 |
| Molecular Formula | C24H28O3S |
| Molecular Weight | 396.55 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | [(3R)-oct-1-en-3-yl] 2-(diphenyl-λ4-sulfanylidene)-3-oxobutanoate |
| SMILES | C=C[C@@H](CCCCC)OC(=O)C(C(C)=O)=S(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H28O3S/c1-4-6-9-14-20(5-2)27-24(26)23(19(3)25)28(21-15-10-7-11-16-21)22-17-12-8-13-18-22/h5,7-8,10-13,15-18,20H,2,4,6,9,14H2,1,3H3/t20-/m0/s1 |
| InChIKey | RSGFWXWJXCLVAK-FQEVSTJZSA-N |
| XLogP | 5.81 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.55 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|