C24H30O4 — CID 91717323
1-O-(naphthalen-2-ylmethyl) 5-O-oct-1-en-3-yl pentanedioate (PubChem CID 91717323) has the molecular formula C24H30O4 and a molecular weight of 382.50 g/mol. Its IUPAC name is 1-O-(naphthalen-2-ylmethyl) 5-O-oct-1-en-3-yl pentanedioate.
| Compound Name | 1-O-(naphthalen-2-ylmethyl) 5-O-oct-1-en-3-yl pentanedioate |
|---|---|
| PubChem CID | 91717323 |
| Molecular Formula | C24H30O4 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 1-O-(naphthalen-2-ylmethyl) 5-O-oct-1-en-3-yl pentanedioate |
| SMILES | C=CC(CCCCC)OC(=O)CCCC(=O)OCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C24H30O4/c1-3-5-6-12-22(4-2)28-24(26)14-9-13-23(25)27-18-19-15-16-20-10-7-8-11-21(20)17-19/h4,7-8,10-11,15-17,22H,2-3,5-6,9,12-14,18H2,1H3 |
| InChIKey | QMQATFFPEQDZTB-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|