C16H20BrNO5 — CID 122394682
dimethyl 2-[5-bromo-2-(tert-butylcarbamoyl)phenyl]propanedioate (PubChem CID 122394682) has the molecular formula C16H20BrNO5 and a molecular weight of 386.24 g/mol. Its IUPAC name is dimethyl 2-[5-bromo-2-(tert-butylcarbamoyl)phenyl]propanedioate.
| Compound Name | dimethyl 2-[5-bromo-2-(tert-butylcarbamoyl)phenyl]propanedioate |
|---|---|
| PubChem CID | 122394682 |
| Molecular Formula | C16H20BrNO5 |
| Molecular Weight | 386.24 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | dimethyl 2-[5-bromo-2-(tert-butylcarbamoyl)phenyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)c1cc(Br)ccc1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H20BrNO5/c1-16(2,3)18-13(19)10-7-6-9(17)8-11(10)12(14(20)22-4)15(21)23-5/h6-8,12H,1-5H3,(H,18,19) |
| InChIKey | GOMUSKLEVGOFMF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|