C11H14N5O+ — CID 122394997
N-(5-amino-4-methyl-1-phenyl-1,2,4-triazol-4-ium-3-yl)acetamide (PubChem CID 122394997) has the molecular formula C11H14N5O+ and a molecular weight of 232.27 g/mol. Its IUPAC name is N-(5-amino-4-methyl-1-phenyl-1,2,4-triazol-4-ium-3-yl)acetamide.
| Compound Name | N-(5-amino-4-methyl-1-phenyl-1,2,4-triazol-4-ium-3-yl)acetamide |
|---|---|
| PubChem CID | 122394997 |
| Molecular Formula | C11H14N5O+ |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(5-amino-4-methyl-1-phenyl-1,2,4-triazol-4-ium-3-yl)acetamide |
| SMILES | CC(=O)Nc1nn(-c2ccccc2)c(N)[n+]1C |
| InChI | InChI=1S/C11H13N5O/c1-8(17)13-11-14-16(10(12)15(11)2)9-6-4-3-5-7-9/h3-7,12H,1-2H3,(H,13,14,17)/p+1 |
| InChIKey | WSFKNBOJHOFNOH-UHFFFAOYSA-O |
| XLogP | 0.24 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|