C16H12ClNO4 — CID 122395693
3-(4-chlorophenyl)-3-hydroxy-2-methoxyisoquinoline-1,4-dione (PubChem CID 122395693) has the molecular formula C16H12ClNO4 and a molecular weight of 317.73 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-3-hydroxy-2-methoxyisoquinoline-1,4-dione.
| Compound Name | 3-(4-chlorophenyl)-3-hydroxy-2-methoxyisoquinoline-1,4-dione |
|---|---|
| PubChem CID | 122395693 |
| Molecular Formula | C16H12ClNO4 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 3-(4-chlorophenyl)-3-hydroxy-2-methoxyisoquinoline-1,4-dione |
| SMILES | CON1C(=O)c2ccccc2C(=O)C1(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H12ClNO4/c1-22-18-15(20)13-5-3-2-4-12(13)14(19)16(18,21)10-6-8-11(17)9-7-10/h2-9,21H,1H3 |
| InChIKey | SMBOYDNENBYAOZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |