C19H26O7 — CID 122396445
diethyl 2-[(2R,3S)-2-(2,5-dimethoxyphenyl)oxolan-3-yl]propanedioate (PubChem CID 122396445) has the molecular formula C19H26O7 and a molecular weight of 366.41 g/mol. Its IUPAC name is diethyl 2-[(2R,3S)-2-(2,5-dimethoxyphenyl)oxolan-3-yl]propanedioate.
| Compound Name | diethyl 2-[(2R,3S)-2-(2,5-dimethoxyphenyl)oxolan-3-yl]propanedioate |
|---|---|
| PubChem CID | 122396445 |
| Molecular Formula | C19H26O7 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | diethyl 2-[(2R,3S)-2-(2,5-dimethoxyphenyl)oxolan-3-yl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1CCO[C@H]1c1cc(OC)ccc1OC |
| InChI | InChI=1S/C19H26O7/c1-5-24-18(20)16(19(21)25-6-2)13-9-10-26-17(13)14-11-12(22-3)7-8-15(14)23-4/h7-8,11,13,16-17H,5-6,9-10H2,1-4H3/t13-,17+/m0/s1 |
| InChIKey | OJFLCAGNRPVSCM-SUMWQHHRSA-N |
| XLogP | 2.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|