C21H28O6 — CID 101041543
diethyl 2-[(1R,2R)-2-(4-methoxybenzoyl)cyclohexyl]propanedioate (PubChem CID 101041543) has the molecular formula C21H28O6 and a molecular weight of 376.45 g/mol. Its IUPAC name is diethyl 2-[(1R,2R)-2-(4-methoxybenzoyl)cyclohexyl]propanedioate.
| Compound Name | diethyl 2-[(1R,2R)-2-(4-methoxybenzoyl)cyclohexyl]propanedioate |
|---|---|
| PubChem CID | 101041543 |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | diethyl 2-[(1R,2R)-2-(4-methoxybenzoyl)cyclohexyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)[C@@H]1CCCC[C@H]1C(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H28O6/c1-4-26-20(23)18(21(24)27-5-2)16-8-6-7-9-17(16)19(22)14-10-12-15(25-3)13-11-14/h10-13,16-18H,4-9H2,1-3H3/t16-,17-/m1/s1 |
| InChIKey | VJPDGGQNNNIWAU-IAGOWNOFSA-N |
| XLogP | 3.43 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|