C18H28N2P2 — CID 122397570
N-[8-(diethylaminophosphanyl)naphthalen-1-yl]phosphanyl-N-ethylethanamine (PubChem CID 122397570) has the molecular formula C18H28N2P2 and a molecular weight of 334.38 g/mol. Its IUPAC name is N-[8-(diethylaminophosphanyl)naphthalen-1-yl]phosphanyl-N-ethylethanamine.
| Compound Name | N-[8-(diethylaminophosphanyl)naphthalen-1-yl]phosphanyl-N-ethylethanamine |
|---|---|
| PubChem CID | 122397570 |
| Molecular Formula | C18H28N2P2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | N-[8-(diethylaminophosphanyl)naphthalen-1-yl]phosphanyl-N-ethylethanamine |
| SMILES | CCN(CC)Pc1cccc2cccc(PN(CC)CC)c12 |
| InChI | InChI=1S/C18H28N2P2/c1-5-19(6-2)21-16-13-9-11-15-12-10-14-17(18(15)16)22-20(7-3)8-4/h9-14,21-22H,5-8H2,1-4H3 |
| InChIKey | SBZWAPXQYCSSMR-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|