C7H10FN — CID 122401987
(2Z,4E,6R)-6-fluorohepta-2,4-dien-1-imine (PubChem CID 122401987) has the molecular formula C7H10FN and a molecular weight of 127.16 g/mol. Its IUPAC name is (2Z,4E,6R)-6-fluorohepta-2,4-dien-1-imine.
| Compound Name | (2Z,4E,6R)-6-fluorohepta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 122401987 |
| Molecular Formula | C7H10FN |
| Molecular Weight | 127.16 g/mol |
| Exact Mass | 127.08 |
| IUPAC Name | (2Z,4E,6R)-6-fluorohepta-2,4-dien-1-imine |
| SMILES | [H]/N=C/C=C\C=C\[C@@H](C)F |
| InChI | InChI=1S/C7H10FN/c1-7(8)5-3-2-4-6-9/h2-7,9H,1H3/b4-2-,5-3+,9-6+/t7-/m1/s1 |
| InChIKey | GEPIPJDXWWYJPI-BJWFMZLISA-N |
| XLogP | 2.11 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.16 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|