C15H13N — CID 122403892
1,4-dimethylphenanthridine (PubChem CID 122403892) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is 1,4-dimethylphenanthridine.
| Compound Name | 1,4-dimethylphenanthridine |
|---|---|
| PubChem CID | 122403892 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 1,4-dimethylphenanthridine |
| SMILES | Cc1ccc(C)c2c1ncc1ccccc12 |
| InChI | InChI=1S/C15H13N/c1-10-7-8-11(2)15-14(10)13-6-4-3-5-12(13)9-16-15/h3-9H,1-2H3 |
| InChIKey | SCDVPVFVCTZBOH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|