C19H19N — CID 58971578
4-methyl-3-(3,4,5-trimethylphenyl)isoquinoline (PubChem CID 58971578) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is 4-methyl-3-(3,4,5-trimethylphenyl)isoquinoline.
| Compound Name | 4-methyl-3-(3,4,5-trimethylphenyl)isoquinoline |
|---|---|
| PubChem CID | 58971578 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | 4-methyl-3-(3,4,5-trimethylphenyl)isoquinoline |
| SMILES | Cc1cc(-c2ncc3ccccc3c2C)cc(C)c1C |
| InChI | InChI=1S/C19H19N/c1-12-9-17(10-13(2)14(12)3)19-15(4)18-8-6-5-7-16(18)11-20-19/h5-11H,1-4H3 |
| InChIKey | MUWQTLONDGHNCV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |