C26H17F6N — CID 59859389
4-methyl-3-[9-methyl-7,9-bis(trifluoromethyl)fluoren-2-yl]isoquinoline (PubChem CID 59859389) has the molecular formula C26H17F6N and a molecular weight of 457.42 g/mol. Its IUPAC name is 4-methyl-3-[9-methyl-7,9-bis(trifluoromethyl)fluoren-2-yl]isoquinoline.
| Compound Name | 4-methyl-3-[9-methyl-7,9-bis(trifluoromethyl)fluoren-2-yl]isoquinoline |
|---|---|
| PubChem CID | 59859389 |
| Molecular Formula | C26H17F6N |
| Molecular Weight | 457.42 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 4-methyl-3-[9-methyl-7,9-bis(trifluoromethyl)fluoren-2-yl]isoquinoline |
| SMILES | Cc1c(-c2ccc3c(c2)C(C)(C(F)(F)F)c2cc(C(F)(F)F)ccc2-3)ncc2ccccc12 |
| InChI | InChI=1S/C26H17F6N/c1-14-18-6-4-3-5-16(18)13-33-23(14)15-7-9-19-20-10-8-17(25(27,28)29)12-22(20)24(2,21(19)11-15)26(30,31)32/h3-13H,1-2H3 |
| InChIKey | WRWKFPUKEPWVJL-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.42 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |