C25H12F9N — CID 59859395
2-[7,9,9-tris(trifluoromethyl)fluoren-2-yl]quinoline (PubChem CID 59859395) has the molecular formula C25H12F9N and a molecular weight of 497.36 g/mol. Its IUPAC name is 2-[7,9,9-tris(trifluoromethyl)fluoren-2-yl]quinoline.
| Compound Name | 2-[7,9,9-tris(trifluoromethyl)fluoren-2-yl]quinoline |
|---|---|
| PubChem CID | 59859395 |
| Molecular Formula | C25H12F9N |
| Molecular Weight | 497.36 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 2-[7,9,9-tris(trifluoromethyl)fluoren-2-yl]quinoline |
| SMILES | FC(F)(F)c1ccc2c(c1)C(C(F)(F)F)(C(F)(F)F)c1cc(-c3ccc4ccccc4n3)ccc1-2 |
| InChI | InChI=1S/C25H12F9N/c26-23(27,28)15-7-9-17-16-8-5-14(21-10-6-13-3-1-2-4-20(13)35-21)11-18(16)22(19(17)12-15,24(29,30)31)25(32,33)34/h1-12H |
| InChIKey | LEQXUKBDKUJNQG-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.36 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |