C24H13F6N — CID 59859336
2-[9,9-bis(trifluoromethyl)fluoren-4-yl]quinoline (PubChem CID 59859336) has the molecular formula C24H13F6N and a molecular weight of 429.36 g/mol. Its IUPAC name is 2-[9,9-bis(trifluoromethyl)fluoren-4-yl]quinoline.
| Compound Name | 2-[9,9-bis(trifluoromethyl)fluoren-4-yl]quinoline |
|---|---|
| PubChem CID | 59859336 |
| Molecular Formula | C24H13F6N |
| Molecular Weight | 429.36 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-[9,9-bis(trifluoromethyl)fluoren-4-yl]quinoline |
| SMILES | FC(F)(F)C1(C(F)(F)F)c2ccccc2-c2c(-c3ccc4ccccc4n3)cccc21 |
| InChI | InChI=1S/C24H13F6N/c25-23(26,27)22(24(28,29)30)17-9-3-2-7-15(17)21-16(8-5-10-18(21)22)20-13-12-14-6-1-4-11-19(14)31-20/h1-13H |
| InChIKey | FVMQSOGWXUDQLX-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.36 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |