C25H20IrN- — CID 177115881
iridium;2-(4,9,9-trimethyl-3H-fluoren-3-id-2-yl)quinoline (PubChem CID 177115881) has the molecular formula C25H20IrN- and a molecular weight of 526.66 g/mol. Its IUPAC name is iridium;2-(4,9,9-trimethyl-3H-fluoren-3-id-2-yl)quinoline.
| Compound Name | iridium;2-(4,9,9-trimethyl-3H-fluoren-3-id-2-yl)quinoline |
|---|---|
| PubChem CID | 177115881 |
| Molecular Formula | C25H20IrN- |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | iridium;2-(4,9,9-trimethyl-3H-fluoren-3-id-2-yl)quinoline |
| SMILES | Cc1[c-]c(-c2ccc3ccccc3n2)cc2c1-c1ccccc1C2(C)C.[Ir] |
| InChI | InChI=1S/C25H20N.Ir/c1-16-14-18(23-13-12-17-8-4-7-11-22(17)26-23)15-21-24(16)19-9-5-6-10-20(19)25(21,2)3;/h4-13,15H,1-3H3;/q-1; |
| InChIKey | YINLGJZMVGMQOW-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|