C45H35N3 — CID 90068471
2-[2-(3,5-dipyridin-4-ylphenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]quinoline (PubChem CID 90068471) has the molecular formula C45H35N3 and a molecular weight of 617.80 g/mol. Its IUPAC name is 2-[2-(3,5-dipyridin-4-ylphenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]quinoline.
| Compound Name | 2-[2-(3,5-dipyridin-4-ylphenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]quinoline |
|---|---|
| PubChem CID | 90068471 |
| Molecular Formula | C45H35N3 |
| Molecular Weight | 617.80 g/mol |
| Exact Mass | 617.28 |
| IUPAC Name | 2-[2-(3,5-dipyridin-4-ylphenyl)-5,5,10,10-tetramethylindeno[2,1-a]inden-7-yl]quinoline |
| SMILES | CC1(C)C2=C(c3ccc(-c4cc(-c5ccncc5)cc(-c5ccncc5)c4)cc31)C(C)(C)c1cc(-c3ccc4ccccc4n3)ccc12 |
| InChI | InChI=1S/C45H35N3/c1-44(2)38-26-31(35-24-33(28-15-19-46-20-16-28)23-34(25-35)29-17-21-47-22-18-29)9-12-36(38)42-43(44)37-13-10-32(27-39(37)45(42,3)4)41-14-11-30-7-5-6-8-40(30)48-41/h5-27H,1-4H3 |
| InChIKey | DBRBCLWTCDBFLT-UHFFFAOYSA-N |
| XLogP | 11.19 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.80 |
| LogP ≤ 5 | 11.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|