C45H36N2 — CID 90068448
3-phenyl-2-[4-(5,5,10,10-tetramethyl-7-phenylindeno[2,1-a]inden-2-yl)phenyl]imidazo[1,2-a]pyridine (PubChem CID 90068448) has the molecular formula C45H36N2 and a molecular weight of 604.80 g/mol. Its IUPAC name is 3-phenyl-2-[4-(5,5,10,10-tetramethyl-7-phenylindeno[2,1-a]inden-2-yl)phenyl]imidazo[1,2-a]pyridine.
| Compound Name | 3-phenyl-2-[4-(5,5,10,10-tetramethyl-7-phenylindeno[2,1-a]inden-2-yl)phenyl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 90068448 |
| Molecular Formula | C45H36N2 |
| Molecular Weight | 604.80 g/mol |
| Exact Mass | 604.29 |
| IUPAC Name | 3-phenyl-2-[4-(5,5,10,10-tetramethyl-7-phenylindeno[2,1-a]inden-2-yl)phenyl]imidazo[1,2-a]pyridine |
| SMILES | CC1(C)C2=C(c3ccc(-c4ccccc4)cc31)C(C)(C)c1cc(-c3ccc(-c4nc5ccccn5c4-c4ccccc4)cc3)ccc12 |
| InChI | InChI=1S/C45H36N2/c1-44(2)37-27-33(29-13-7-5-8-14-29)22-24-35(37)40-41(44)36-25-23-34(28-38(36)45(40,3)4)30-18-20-31(21-19-30)42-43(32-15-9-6-10-16-32)47-26-12-11-17-39(47)46-42/h5-28H,1-4H3 |
| InChIKey | MKEMDAZFOPDDAE-UHFFFAOYSA-N |
| XLogP | 11.50 |
| TPSA | 17.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.80 |
| LogP ≤ 5 | 11.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|