C53H35N5 — CID 168835942
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-3-phenylimidazo[1,2-a]pyridine (PubChem CID 168835942) has the molecular formula C53H35N5 and a molecular weight of 741.90 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-3-phenylimidazo[1,2-a]pyridine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-3-phenylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 168835942 |
| Molecular Formula | C53H35N5 |
| Molecular Weight | 741.90 g/mol |
| Exact Mass | 741.29 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)-9,9-diphenylfluoren-2-yl]-3-phenylimidazo[1,2-a]pyridine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3cc(-c5nc6ccccn6c5-c5ccccc5)ccc3-4)n2)cc1 |
| InChI | InChI=1S/C53H35N5/c1-6-18-36(19-7-1)49-48(54-47-28-16-17-33-58(47)49)39-29-31-43-44-32-30-40(52-56-50(37-20-8-2-9-21-37)55-51(57-52)38-22-10-3-11-23-38)35-46(44)53(45(43)34-39,41-24-12-4-13-25-41)42-26-14-5-15-27-42/h1-35H |
| InChIKey | SUSJZUOBJRGSBR-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.90 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |