C23H24N2O4 — CID 122414157
(E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-(3,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 122414157) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-(3,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-(3,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 122414157 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (E)-3-[3-[3,4-bis(hydroxymethyl)-5-methoxyphenyl]-1H-pyrazol-5-yl]-1-(3,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | COc1cc(-c2cc(/C=C/C(=O)c3ccc(C)c(C)c3)[nH]n2)cc(CO)c1CO |
| InChI | InChI=1S/C23H24N2O4/c1-14-4-5-16(8-15(14)2)22(28)7-6-19-11-21(25-24-19)17-9-18(12-26)20(13-27)23(10-17)29-3/h4-11,26-27H,12-13H2,1-3H3,(H,24,25)/b7-6+ |
| InChIKey | VRIZNSFXCQCZNW-VOTSOKGWSA-N |
| XLogP | 3.58 |
| TPSA | 95.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|