C60H43N5 — CID 122416167
2-(2,5-dimethyl-4-phenylphenyl)-4-(2-methyl-4-pyridin-2-ylphenyl)-6-[3-phenanthren-9-yl-5-(4-pyridin-3-ylphenyl)phenyl]-1,3,5-triazine (PubChem CID 122416167) has the molecular formula C60H43N5 and a molecular weight of 834.04 g/mol. Its IUPAC name is 2-(2,5-dimethyl-4-phenylphenyl)-4-(2-methyl-4-pyridin-2-ylphenyl)-6-[3-phenanthren-9-yl-5-(4-pyridin-3-ylphenyl)phenyl]-1,3,5-triazine.
| Compound Name | 2-(2,5-dimethyl-4-phenylphenyl)-4-(2-methyl-4-pyridin-2-ylphenyl)-6-[3-phenanthren-9-yl-5-(4-pyridin-3-ylphenyl)phenyl]-1,3,5-triazine |
|---|---|
| PubChem CID | 122416167 |
| Molecular Formula | C60H43N5 |
| Molecular Weight | 834.04 g/mol |
| Exact Mass | 833.35 |
| IUPAC Name | 2-(2,5-dimethyl-4-phenylphenyl)-4-(2-methyl-4-pyridin-2-ylphenyl)-6-[3-phenanthren-9-yl-5-(4-pyridin-3-ylphenyl)phenyl]-1,3,5-triazine |
| SMILES | Cc1cc(-c2nc(-c3cc(-c4ccc(-c5cccnc5)cc4)cc(-c4cc5ccccc5c5ccccc45)c3)nc(-c3ccc(-c4ccccn4)cc3C)n2)c(C)cc1-c1ccccc1 |
| InChI | InChI=1S/C60H43N5/c1-38-30-45(57-21-11-12-29-62-57)26-27-50(38)59-63-58(64-60(65-59)55-32-39(2)54(31-40(55)3)43-14-5-4-6-15-43)49-34-47(42-24-22-41(23-25-42)46-17-13-28-61-37-46)33-48(35-49)56-36-44-16-7-8-18-51(44)52-19-9-10-20-53(52)56/h4-37H,1-3H3 |
| InChIKey | CUCVYSSFHUJBSY-UHFFFAOYSA-N |
| XLogP | 15.23 |
| TPSA | 64.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.04 |
| LogP ≤ 5 | 15.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|