C24H20N2O6S — CID 1224198
N-(3-acetylphenyl)-4-[[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide (PubChem CID 1224198) has the molecular formula C24H20N2O6S and a molecular weight of 464.50 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-[[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide.
| Compound Name | N-(3-acetylphenyl)-4-[[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
|---|---|
| PubChem CID | 1224198 |
| Molecular Formula | C24H20N2O6S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | N-(3-acetylphenyl)-4-[[(E)-3-(1,3-benzodioxol-5-yl)-3-oxoprop-1-enyl]amino]benzenesulfonamide |
| SMILES | CC(=O)c1cccc(NS(=O)(=O)c2ccc(N/C=C/C(=O)c3ccc4c(c3)OCO4)cc2)c1 |
| InChI | InChI=1S/C24H20N2O6S/c1-16(27)17-3-2-4-20(13-17)26-33(29,30)21-8-6-19(7-9-21)25-12-11-22(28)18-5-10-23-24(14-18)32-15-31-23/h2-14,25-26H,15H2,1H3/b12-11+ |
| InChIKey | DMIIDXSDAPTVHQ-VAWYXSNFSA-N |
| XLogP | 4.23 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|