C20H11ClF6N2O5S — CID 122422365
4-[5-chloro-6-(2,3,6-trifluorophenoxy)-3-pyridinyl]-5-(difluoromethoxy)-2-fluoro-N-methylsulfonylbenzamide (PubChem CID 122422365) has the molecular formula C20H11ClF6N2O5S and a molecular weight of 540.83 g/mol. Its IUPAC name is 4-[5-chloro-6-(2,3,6-trifluorophenoxy)-3-pyridinyl]-5-(difluoromethoxy)-2-fluoro-N-methylsulfonylbenzamide.
| Compound Name | 4-[5-chloro-6-(2,3,6-trifluorophenoxy)-3-pyridinyl]-5-(difluoromethoxy)-2-fluoro-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122422365 |
| Molecular Formula | C20H11ClF6N2O5S |
| Molecular Weight | 540.83 g/mol |
| Exact Mass | 540.00 |
| IUPAC Name | 4-[5-chloro-6-(2,3,6-trifluorophenoxy)-3-pyridinyl]-5-(difluoromethoxy)-2-fluoro-N-methylsulfonylbenzamide |
| SMILES | CS(=O)(=O)NC(=O)c1cc(OC(F)F)c(-c2cnc(Oc3c(F)ccc(F)c3F)c(Cl)c2)cc1F |
| InChI | InChI=1S/C20H11ClF6N2O5S/c1-35(31,32)29-18(30)10-6-15(33-20(26)27)9(5-14(10)24)8-4-11(21)19(28-7-8)34-17-13(23)3-2-12(22)16(17)25/h2-7,20H,1H3,(H,29,30) |
| InChIKey | WFKTZLCRSNGSSV-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.83 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|