C20H13ClF4N2O4S — CID 122422434
4-[5-chloro-6-(2,3,4-trifluorophenoxy)-3-pyridinyl]-2-fluoro-5-methyl-N-methylsulfonylbenzamide (PubChem CID 122422434) has the molecular formula C20H13ClF4N2O4S and a molecular weight of 488.85 g/mol. Its IUPAC name is 4-[5-chloro-6-(2,3,4-trifluorophenoxy)-3-pyridinyl]-2-fluoro-5-methyl-N-methylsulfonylbenzamide.
| Compound Name | 4-[5-chloro-6-(2,3,4-trifluorophenoxy)-3-pyridinyl]-2-fluoro-5-methyl-N-methylsulfonylbenzamide |
|---|---|
| PubChem CID | 122422434 |
| Molecular Formula | C20H13ClF4N2O4S |
| Molecular Weight | 488.85 g/mol |
| Exact Mass | 488.02 |
| IUPAC Name | 4-[5-chloro-6-(2,3,4-trifluorophenoxy)-3-pyridinyl]-2-fluoro-5-methyl-N-methylsulfonylbenzamide |
| SMILES | Cc1cc(C(=O)NS(C)(=O)=O)c(F)cc1-c1cnc(Oc2ccc(F)c(F)c2F)c(Cl)c1 |
| InChI | InChI=1S/C20H13ClF4N2O4S/c1-9-5-12(19(28)27-32(2,29)30)15(23)7-11(9)10-6-13(21)20(26-8-10)31-16-4-3-14(22)17(24)18(16)25/h3-8H,1-2H3,(H,27,28) |
| InChIKey | AGEGKXCNHHAHLC-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|