C13H14F3NO4S — CID 122424290
4-[difluoro-(3-fluorophenyl)sulfonylmethyl]piperidine-1-carboxylic acid (PubChem CID 122424290) has the molecular formula C13H14F3NO4S and a molecular weight of 337.32 g/mol. Its IUPAC name is 4-[difluoro-(3-fluorophenyl)sulfonylmethyl]piperidine-1-carboxylic acid.
| Compound Name | 4-[difluoro-(3-fluorophenyl)sulfonylmethyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 122424290 |
| Molecular Formula | C13H14F3NO4S |
| Molecular Weight | 337.32 g/mol |
| Exact Mass | 337.06 |
| IUPAC Name | 4-[difluoro-(3-fluorophenyl)sulfonylmethyl]piperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(C(F)(F)S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C13H14F3NO4S/c14-10-2-1-3-11(8-10)22(20,21)13(15,16)9-4-6-17(7-5-9)12(18)19/h1-3,8-9H,4-7H2,(H,18,19) |
| InChIKey | HZSZXUAIKMHETO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |