C19H24FN3O2S — CID 155253220
5-[4-[2-(3-fluorophenyl)sulfonylpropan-2-yl]piperidin-1-yl]-2-methylpyrimidine (PubChem CID 155253220) has the molecular formula C19H24FN3O2S and a molecular weight of 377.49 g/mol. Its IUPAC name is 5-[4-[2-(3-fluorophenyl)sulfonylpropan-2-yl]piperidin-1-yl]-2-methylpyrimidine.
| Compound Name | 5-[4-[2-(3-fluorophenyl)sulfonylpropan-2-yl]piperidin-1-yl]-2-methylpyrimidine |
|---|---|
| PubChem CID | 155253220 |
| Molecular Formula | C19H24FN3O2S |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 5-[4-[2-(3-fluorophenyl)sulfonylpropan-2-yl]piperidin-1-yl]-2-methylpyrimidine |
| SMILES | Cc1ncc(N2CCC(C(C)(C)S(=O)(=O)c3cccc(F)c3)CC2)cn1 |
| InChI | InChI=1S/C19H24FN3O2S/c1-14-21-12-17(13-22-14)23-9-7-15(8-10-23)19(2,3)26(24,25)18-6-4-5-16(20)11-18/h4-6,11-13,15H,7-10H2,1-3H3 |
| InChIKey | AAKWOXUMGLLYSF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |