C19H21F4N3O2S — CID 139451745
2-fluoro-5-[4-[2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propan-2-yl]piperidin-1-yl]pyridine (PubChem CID 139451745) has the molecular formula C19H21F4N3O2S and a molecular weight of 431.46 g/mol. Its IUPAC name is 2-fluoro-5-[4-[2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propan-2-yl]piperidin-1-yl]pyridine.
| Compound Name | 2-fluoro-5-[4-[2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propan-2-yl]piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 139451745 |
| Molecular Formula | C19H21F4N3O2S |
| Molecular Weight | 431.46 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-fluoro-5-[4-[2-[[6-(trifluoromethyl)-3-pyridinyl]sulfonyl]propan-2-yl]piperidin-1-yl]pyridine |
| SMILES | CC(C)(C1CCN(c2ccc(F)nc2)CC1)S(=O)(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C19H21F4N3O2S/c1-18(2,29(27,28)15-4-5-16(24-12-15)19(21,22)23)13-7-9-26(10-8-13)14-3-6-17(20)25-11-14/h3-6,11-13H,7-10H2,1-2H3 |
| InChIKey | KURNMDFSTHIFTF-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.46 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|