C73H54N2O4S2 — CID 122429621
4-[bis[4-[4-(benzenesulfonyl)phenyl]phenyl]-[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline (PubChem CID 122429621) has the molecular formula C73H54N2O4S2 and a molecular weight of 1087.38 g/mol. Its IUPAC name is 4-[bis[4-[4-(benzenesulfonyl)phenyl]phenyl]-[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline.
| Compound Name | 4-[bis[4-[4-(benzenesulfonyl)phenyl]phenyl]-[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 122429621 |
| Molecular Formula | C73H54N2O4S2 |
| Molecular Weight | 1087.38 g/mol |
| Exact Mass | 1086.35 |
| IUPAC Name | 4-[bis[4-[4-(benzenesulfonyl)phenyl]phenyl]-[4-(N-phenylanilino)phenyl]methyl]-N,N-diphenylaniline |
| SMILES | O=S(=O)(c1ccccc1)c1ccc(-c2ccc(C(c3ccc(-c4ccc(S(=O)(=O)c5ccccc5)cc4)cc3)(c3ccc(N(c4ccccc4)c4ccccc4)cc3)c3ccc(N(c4ccccc4)c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C73H54N2O4S2/c76-80(77,69-27-15-5-16-28-69)71-51-35-57(36-52-71)55-31-39-59(40-32-55)73(61-43-47-67(48-44-61)74(63-19-7-1-8-20-63)64-21-9-2-10-22-64,62-45-49-68(50-46-62)75(65-23-11-3-12-24-65)66-25-13-4-14-26-66)60-41-33-56(34-42-60)58-37-53-72(54-38-58)81(78,79)70-29-17-6-18-30-70/h1-54H |
| InChIKey | FBACBJRGXIAQOH-UHFFFAOYSA-N |
| XLogP | 18.01 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 81 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1087.38 |
| LogP ≤ 5 | 18.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|