About [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol
[3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol (PubChem CID 122429884) has the molecular formula C18H15N5O
and a molecular weight of 317.35 g/mol. Its IUPAC name is [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol |
| PubChem CID | 122429884 |
| Molecular Formula | C18H15N5O |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol |
| SMILES | OCc1cccc(Nc2nccc(-c3cnc4ccccn34)n2)c1 |
| InChI | InChI=1S/C18H15N5O/c24-12-13-4-3-5-14(10-13)21-18-19-8-7-15(22-18)16-11-20-17-6-1-2-9-23(16)17/h1-11,24H,12H2,(H,19,21,22) |
| InChIKey | AKIGSCXPWVCCMK-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol?
The IUPAC name of [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol (CID 122429884) is [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol.
What is the SMILES notation for [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol?
The canonical SMILES for [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol is OCc1cccc(Nc2nccc(-c3cnc4ccccn34)n2)c1.
What is the InChIKey of [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol?
The InChIKey is AKIGSCXPWVCCMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N5O/c24-12-13-4-3-5-14(10-13)21-18-19-8-7-15(22-18)16-11-20-17-6-1-2-9-23(16)17/h1-11,24H,12H2,(H,19,21,22).
What are the key properties of [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol?
[3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol has a molecular weight of 317.35 g/mol, XLogP of 3.03, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(4-imidazo[1,2-a]pyridin-3-ylpyrimidin-2-yl)amino]phenyl]methanol is sourced from PubChem (CID 122429884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).