C19H22N2O4 — CID 122430362
methyl 4-(4-methoxyphenyl)-2-[(pent-4-enoylamino)methyl]-3H-pyrrole-5-carboxylate (PubChem CID 122430362) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is methyl 4-(4-methoxyphenyl)-2-[(pent-4-enoylamino)methyl]-3H-pyrrole-5-carboxylate.
| Compound Name | methyl 4-(4-methoxyphenyl)-2-[(pent-4-enoylamino)methyl]-3H-pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 122430362 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | methyl 4-(4-methoxyphenyl)-2-[(pent-4-enoylamino)methyl]-3H-pyrrole-5-carboxylate |
| SMILES | C=CCCC(=O)NCC1=NC(C(=O)OC)=C(c2ccc(OC)cc2)C1 |
| InChI | InChI=1S/C19H22N2O4/c1-4-5-6-17(22)20-12-14-11-16(18(21-14)19(23)25-3)13-7-9-15(24-2)10-8-13/h4,7-10H,1,5-6,11-12H2,2-3H3,(H,20,22) |
| InChIKey | BBULEFJCDGSKEB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|