C9H9N3O2 — CID 122431840
6-methoxy-3-methyl-1,2,3-benzotriazin-4-one (PubChem CID 122431840) has the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. Its IUPAC name is 6-methoxy-3-methyl-1,2,3-benzotriazin-4-one.
| Compound Name | 6-methoxy-3-methyl-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 122431840 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | 6-methoxy-3-methyl-1,2,3-benzotriazin-4-one |
| SMILES | COc1ccc2nnn(C)c(=O)c2c1 |
| InChI | InChI=1S/C9H9N3O2/c1-12-9(13)7-5-6(14-2)3-4-8(7)10-11-12/h3-5H,1-2H3 |
| InChIKey | MEGZEGKZAFATBZ-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |