About 4,6-dimethoxycinnoline
4,6-dimethoxycinnoline (PubChem CID 134989956) has the molecular formula C10H10N2O2
and a molecular weight of 190.20 g/mol. Its IUPAC name is 4,6-dimethoxycinnoline.
Molecular Properties
| Compound Name | 4,6-dimethoxycinnoline |
| PubChem CID | 134989956 |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 4,6-dimethoxycinnoline |
| SMILES | COc1ccc2nncc(OC)c2c1 |
| InChI | InChI=1S/C10H10N2O2/c1-13-7-3-4-9-8(5-7)10(14-2)6-11-12-9/h3-6H,1-2H3 |
| InChIKey | TVTHFCUWNKAMPT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4,6-dimethoxycinnoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dimethoxycinnoline?
The IUPAC name of 4,6-dimethoxycinnoline (CID 134989956) is 4,6-dimethoxycinnoline.
What is the SMILES notation for 4,6-dimethoxycinnoline?
The canonical SMILES for 4,6-dimethoxycinnoline is COc1ccc2nncc(OC)c2c1.
What is the InChIKey of 4,6-dimethoxycinnoline?
The InChIKey is TVTHFCUWNKAMPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10N2O2/c1-13-7-3-4-9-8(5-7)10(14-2)6-11-12-9/h3-6H,1-2H3.
What are the key properties of 4,6-dimethoxycinnoline?
4,6-dimethoxycinnoline has a molecular weight of 190.20 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dimethoxycinnoline is sourced from PubChem (CID 134989956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).