C21H14F3N5O — CID 122433455
N-[3-(3-pyrimidin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 122433455) has the molecular formula C21H14F3N5O and a molecular weight of 409.37 g/mol. Its IUPAC name is N-[3-(3-pyrimidin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[3-(3-pyrimidin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 122433455 |
| Molecular Formula | C21H14F3N5O |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | N-[3-(3-pyrimidin-4-yl-1H-pyrrolo[2,3-b]pyridin-5-yl)-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2cnc3[nH]cc(-c4ccncn4)c3c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C21H14F3N5O/c1-2-19(30)29-15-6-12(5-14(8-15)21(22,23)24)13-7-16-17(10-27-20(16)26-9-13)18-3-4-25-11-28-18/h2-11H,1H2,(H,26,27)(H,29,30) |
| InChIKey | KRNDKAGQOQNYHO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|