C22H17F3N6O — CID 135237524
N-[3-[3-[2-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 135237524) has the molecular formula C22H17F3N6O and a molecular weight of 438.41 g/mol. Its IUPAC name is N-[3-[3-[2-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-[3-[3-[2-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 135237524 |
| Molecular Formula | C22H17F3N6O |
| Molecular Weight | 438.41 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | N-[3-[3-[2-(methylamino)pyrimidin-4-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-5-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(-c2cnc3[nH]cc(-c4ccnc(NC)n4)c3c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F3N6O/c1-3-19(32)30-15-7-12(6-14(9-15)22(23,24)25)13-8-16-17(11-29-20(16)28-10-13)18-4-5-27-21(26-2)31-18/h3-11H,1H2,2H3,(H,28,29)(H,30,32)(H,26,27,31) |
| InChIKey | JCOOSYMKBBRDSS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 95.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|